4-chloro-N-(2-{[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino}ethyl)benzamide
Chemical Structure Depiction of
4-chloro-N-(2-{[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino}ethyl)benzamide
4-chloro-N-(2-{[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino}ethyl)benzamide
Compound characteristics
| Compound ID: | 8013-5215 |
| Compound Name: | 4-chloro-N-(2-{[1-(4-methoxyphenyl)-2,5-dioxopyrrolidin-3-yl]amino}ethyl)benzamide |
| Molecular Weight: | 401.85 |
| Molecular Formula: | C20 H20 Cl N3 O4 |
| Smiles: | COc1ccc(cc1)N1C(CC(C1=O)NCCNC(c1ccc(cc1)[Cl])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.876 |
| logD: | 0.876 |
| logSw: | -2.5653 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.821 |
| InChI Key: | CWRGXIWWEOXZIV-KRWDZBQOSA-N |