8-methoxy-2H-pyrimido[2,1-b][1,3]benzothiazol-2-one
Chemical Structure Depiction of
8-methoxy-2H-pyrimido[2,1-b][1,3]benzothiazol-2-one
8-methoxy-2H-pyrimido[2,1-b][1,3]benzothiazol-2-one
Compound characteristics
| Compound ID: | 8013-6046 |
| Compound Name: | 8-methoxy-2H-pyrimido[2,1-b][1,3]benzothiazol-2-one |
| Molecular Weight: | 232.26 |
| Molecular Formula: | C11 H8 N2 O2 S |
| Smiles: | COc1ccc2c(c1)SC1=NC(C=CN12)=O |
| Stereo: | ACHIRAL |
| logP: | 1.2901 |
| logD: | 1.2901 |
| logSw: | -2.1856 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 32.678 |
| InChI Key: | HHQZVPAQTWLWON-UHFFFAOYSA-N |