ethyl 2-{[2-(2,4-dichlorobenzamido)-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl]amino}-1,3-benzothiazole-6-carboxylate
Chemical Structure Depiction of
ethyl 2-{[2-(2,4-dichlorobenzamido)-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl]amino}-1,3-benzothiazole-6-carboxylate
ethyl 2-{[2-(2,4-dichlorobenzamido)-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl]amino}-1,3-benzothiazole-6-carboxylate
Compound characteristics
| Compound ID: | 8013-7196 |
| Compound Name: | ethyl 2-{[2-(2,4-dichlorobenzamido)-1,1,1-trifluoro-3-methoxy-3-oxopropan-2-yl]amino}-1,3-benzothiazole-6-carboxylate |
| Molecular Weight: | 550.34 |
| Molecular Formula: | C21 H16 Cl2 F3 N3 O5 S |
| Smiles: | CCOC(c1ccc2c(c1)sc(NC(C(=O)OC)(C(F)(F)F)NC(c1ccc(cc1[Cl])[Cl])=O)n2)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.2935 |
| logD: | 3.0171 |
| logSw: | -6.175 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 85.216 |
| InChI Key: | HAVAYMOGLTWHGS-HXUWFJFHSA-N |