N-{[2-(diphenylphosphoryl)phenyl]methyl}-2-hydroxybenzamide
Chemical Structure Depiction of
N-{[2-(diphenylphosphoryl)phenyl]methyl}-2-hydroxybenzamide
N-{[2-(diphenylphosphoryl)phenyl]methyl}-2-hydroxybenzamide
Compound characteristics
| Compound ID: | 8013-7226 |
| Compound Name: | N-{[2-(diphenylphosphoryl)phenyl]methyl}-2-hydroxybenzamide |
| Molecular Weight: | 427.44 |
| Molecular Formula: | C26 H22 N O3 P |
| Smiles: | C(c1ccccc1P(c1ccccc1)(c1ccccc1)=O)NC(c1ccccc1O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2983 |
| logD: | 5.2958 |
| logSw: | -5.2246 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.216 |
| InChI Key: | VEEALBAQPPMJAQ-UHFFFAOYSA-N |