cyclopentyl 4-(4-chlorophenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Chemical Structure Depiction of
cyclopentyl 4-(4-chlorophenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
cyclopentyl 4-(4-chlorophenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 8013-8856 |
| Compound Name: | cyclopentyl 4-(4-chlorophenyl)-7-(2-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Molecular Weight: | 492.01 |
| Molecular Formula: | C29 H30 Cl N O4 |
| Smiles: | CC1=C(C(C2=C(CC(CC2=O)c2ccccc2OC)N1)c1ccc(cc1)[Cl])C(=O)OC1CCCC1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 6.539 |
| logD: | 2.0587 |
| logSw: | -6.594 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.73 |
| InChI Key: | BISNXSWTUBMOGQ-UHFFFAOYSA-N |