ethyl 5-(cyclohexylcarbamoyl)-2-(4-fluorobenzamido)-4-methylthiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 5-(cyclohexylcarbamoyl)-2-(4-fluorobenzamido)-4-methylthiophene-3-carboxylate
ethyl 5-(cyclohexylcarbamoyl)-2-(4-fluorobenzamido)-4-methylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | 8014-0922 |
| Compound Name: | ethyl 5-(cyclohexylcarbamoyl)-2-(4-fluorobenzamido)-4-methylthiophene-3-carboxylate |
| Molecular Weight: | 432.51 |
| Molecular Formula: | C22 H25 F N2 O4 S |
| Smiles: | CCOC(c1c(C)c(C(NC2CCCCC2)=O)sc1NC(c1ccc(cc1)F)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.435 |
| logD: | -0.2669 |
| logSw: | -4.336 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 68.016 |
| InChI Key: | ROBAURRMMKGTQV-UHFFFAOYSA-N |