N-[6,6-dimethyl-1-(4-methylphenyl)-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-2,6-difluorobenzamide
Chemical Structure Depiction of
N-[6,6-dimethyl-1-(4-methylphenyl)-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-2,6-difluorobenzamide
N-[6,6-dimethyl-1-(4-methylphenyl)-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-2,6-difluorobenzamide
Compound characteristics
| Compound ID: | 8014-1290 |
| Compound Name: | N-[6,6-dimethyl-1-(4-methylphenyl)-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-2,6-difluorobenzamide |
| Molecular Weight: | 492.44 |
| Molecular Formula: | C25 H21 F5 N2 O3 |
| Smiles: | Cc1ccc(cc1)N1C2CC(C)(C)CC(C=2C(C1=O)(C(F)(F)F)NC(c1c(cccc1F)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6343 |
| logD: | -2.9056 |
| logSw: | -4.6401 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.711 |
| InChI Key: | SAVBESAQYCCMMI-DEOSSOPVSA-N |