N-[4-(cyanomethyl)phenyl]-2-(thiophen-2-yl)acetamide
Chemical Structure Depiction of
N-[4-(cyanomethyl)phenyl]-2-(thiophen-2-yl)acetamide
N-[4-(cyanomethyl)phenyl]-2-(thiophen-2-yl)acetamide
Compound characteristics
| Compound ID: | 8014-1787 |
| Compound Name: | N-[4-(cyanomethyl)phenyl]-2-(thiophen-2-yl)acetamide |
| Molecular Weight: | 256.32 |
| Molecular Formula: | C14 H12 N2 O S |
| Smiles: | C(C#N)c1ccc(cc1)NC(Cc1cccs1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8662 |
| logD: | 1.8662 |
| logSw: | -2.3737 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.626 |
| InChI Key: | KADLCGLUUHRCFZ-UHFFFAOYSA-N |