4,5-dimethoxy-2-[(4-methoxybenzene-1-sulfonyl)amino]benzoic acid
Chemical Structure Depiction of
4,5-dimethoxy-2-[(4-methoxybenzene-1-sulfonyl)amino]benzoic acid
4,5-dimethoxy-2-[(4-methoxybenzene-1-sulfonyl)amino]benzoic acid
Compound characteristics
| Compound ID: | 8014-1923 |
| Compound Name: | 4,5-dimethoxy-2-[(4-methoxybenzene-1-sulfonyl)amino]benzoic acid |
| Molecular Weight: | 367.38 |
| Molecular Formula: | C16 H17 N O7 S |
| Smiles: | COc1ccc(cc1)S(Nc1cc(c(cc1C(O)=O)OC)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4296 |
| logD: | -0.8194 |
| logSw: | -2.9207 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 91.403 |
| InChI Key: | CXVNCQUZDOKIQM-UHFFFAOYSA-N |