bis(2-methylpropyl) 4-hydroxy-2-(4-hydroxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate
Chemical Structure Depiction of
bis(2-methylpropyl) 4-hydroxy-2-(4-hydroxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate
bis(2-methylpropyl) 4-hydroxy-2-(4-hydroxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate
Compound characteristics
| Compound ID: | 8014-2285 |
| Compound Name: | bis(2-methylpropyl) 4-hydroxy-2-(4-hydroxyphenyl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| Molecular Weight: | 420.5 |
| Molecular Formula: | C23 H32 O7 |
| Smiles: | CC(C)COC(C1C(C(C(=O)OCC(C)C)C(C)(CC1=O)O)c1ccc(cc1)O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.7068 |
| logD: | 3.6877 |
| logSw: | -4.2134 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 88.607 |
| InChI Key: | FVYWGRKLKFZUCH-UHFFFAOYSA-N |