2-[1-({2-[5-(benzyloxy)-2-methyl-1H-indol-3-yl]ethyl}amino)propylidene]cyclohexane-1,3-dione
Chemical Structure Depiction of
2-[1-({2-[5-(benzyloxy)-2-methyl-1H-indol-3-yl]ethyl}amino)propylidene]cyclohexane-1,3-dione
2-[1-({2-[5-(benzyloxy)-2-methyl-1H-indol-3-yl]ethyl}amino)propylidene]cyclohexane-1,3-dione
Compound characteristics
| Compound ID: | 8014-2428 |
| Compound Name: | 2-[1-({2-[5-(benzyloxy)-2-methyl-1H-indol-3-yl]ethyl}amino)propylidene]cyclohexane-1,3-dione |
| Molecular Weight: | 430.55 |
| Molecular Formula: | C27 H30 N2 O3 |
| Smiles: | CCC(=C1C(CCCC1=O)=O)NCCc1c2cc(ccc2[nH]c1C)OCc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.6639 |
| logD: | 4.644 |
| logSw: | -4.7709 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.661 |
| InChI Key: | QEADHSDIJFXPRF-UHFFFAOYSA-N |