5-[(4-bromophenyl)methyl]-2-imino-1,3-selenazolidin-4-one
					Chemical Structure Depiction of
5-[(4-bromophenyl)methyl]-2-imino-1,3-selenazolidin-4-one
			5-[(4-bromophenyl)methyl]-2-imino-1,3-selenazolidin-4-one
Compound characteristics
| Compound ID: | 8014-4689 | 
| Compound Name: | 5-[(4-bromophenyl)methyl]-2-imino-1,3-selenazolidin-4-one | 
| Molecular Weight: | 332.06 | 
| Molecular Formula: | C10 H9 Br N2 O Se | 
| Smiles: | C(C1C(NC(=N)[Se]1)=O)c1ccc(cc1)[Br] | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 1.9866 | 
| logD: | 1.9806 | 
| logSw: | -2.5851 | 
| Hydrogen bond acceptors count: | 3 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 41.314 | 
| InChI Key: | PKCRXABGGWCSGQ-QMMMGPOBSA-N | 
 
				 
				