2-[(4-amino-4H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-chlorophenyl)acetamide
Chemical Structure Depiction of
2-[(4-amino-4H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-chlorophenyl)acetamide
2-[(4-amino-4H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-chlorophenyl)acetamide
Compound characteristics
| Compound ID: | 8014-5895 |
| Compound Name: | 2-[(4-amino-4H-1,2,4-triazol-3-yl)sulfanyl]-N-(3-chlorophenyl)acetamide |
| Molecular Weight: | 283.74 |
| Molecular Formula: | C10 H10 Cl N5 O S |
| Smiles: | C(C(Nc1cccc(c1)[Cl])=O)Sc1nncn1N |
| Stereo: | ACHIRAL |
| logP: | 1.2325 |
| logD: | 1.2324 |
| logSw: | -2.6917 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 65.735 |
| InChI Key: | YRIVWTXTHJPCBC-UHFFFAOYSA-N |