N-(2-bromophenyl)-3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide
Chemical Structure Depiction of
N-(2-bromophenyl)-3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide
N-(2-bromophenyl)-3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide
Compound characteristics
| Compound ID: | 8014-6586 |
| Compound Name: | N-(2-bromophenyl)-3-methoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]benzamide |
| Molecular Weight: | 511.25 |
| Molecular Formula: | C21 H14 Br F3 N2 O5 |
| Smiles: | COc1cc(ccc1Oc1ccc(cc1[N+]([O-])=O)C(F)(F)F)C(Nc1ccccc1[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 5.4406 |
| logD: | 5.4405 |
| logSw: | -5.5767 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.264 |
| InChI Key: | ZXXHIQKYPKMBIU-UHFFFAOYSA-N |