N'-[({5-[(4-methoxyphenyl)methyl]-4-phenyl-4H-1,2,4-triazol-3-yl}sulfanyl)acetyl]-2-methylbenzohydrazide
Chemical Structure Depiction of
N'-[({5-[(4-methoxyphenyl)methyl]-4-phenyl-4H-1,2,4-triazol-3-yl}sulfanyl)acetyl]-2-methylbenzohydrazide
N'-[({5-[(4-methoxyphenyl)methyl]-4-phenyl-4H-1,2,4-triazol-3-yl}sulfanyl)acetyl]-2-methylbenzohydrazide
Compound characteristics
| Compound ID: | 8014-7186 |
| Compound Name: | N'-[({5-[(4-methoxyphenyl)methyl]-4-phenyl-4H-1,2,4-triazol-3-yl}sulfanyl)acetyl]-2-methylbenzohydrazide |
| Molecular Weight: | 487.58 |
| Molecular Formula: | C26 H25 N5 O3 S |
| Smiles: | Cc1ccccc1C(NNC(CSc1nnc(Cc2ccc(cc2)OC)n1c1ccccc1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.5219 |
| logD: | 3.5088 |
| logSw: | -3.8431 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 84.487 |
| InChI Key: | RPJPBUXTWMXHTF-UHFFFAOYSA-N |