5-[(2,3-dichlorophenyl)methyl]-3-phenyl-2-(phenylimino)-1,3-thiazolidin-4-one
Chemical Structure Depiction of
5-[(2,3-dichlorophenyl)methyl]-3-phenyl-2-(phenylimino)-1,3-thiazolidin-4-one
5-[(2,3-dichlorophenyl)methyl]-3-phenyl-2-(phenylimino)-1,3-thiazolidin-4-one
Compound characteristics
| Compound ID: | 8014-7349 |
| Compound Name: | 5-[(2,3-dichlorophenyl)methyl]-3-phenyl-2-(phenylimino)-1,3-thiazolidin-4-one |
| Molecular Weight: | 427.35 |
| Molecular Formula: | C22 H16 Cl2 N2 O S |
| Smiles: | C(C1C(N(/C(=N/c2ccccc2)S1)c1ccccc1)=O)c1cccc(c1[Cl])[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1399 |
| logD: | 6.1399 |
| logSw: | -6.2999 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 24.2526 |
| InChI Key: | PENRTCCVDAAWQS-IBGZPJMESA-N |