7-(2-bromoethoxy)-4-methyl-2H-1-benzopyran-2-one
Chemical Structure Depiction of
7-(2-bromoethoxy)-4-methyl-2H-1-benzopyran-2-one
7-(2-bromoethoxy)-4-methyl-2H-1-benzopyran-2-one
Compound characteristics
| Compound ID: | 8014-7793 |
| Compound Name: | 7-(2-bromoethoxy)-4-methyl-2H-1-benzopyran-2-one |
| Molecular Weight: | 283.12 |
| Molecular Formula: | C12 H11 Br O3 |
| Smiles: | CC1=CC(=O)Oc2cc(ccc12)OCC[Br] |
| Stereo: | ACHIRAL |
| logP: | 2.7146 |
| logD: | 2.7146 |
| logSw: | -3.1675 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.0634 |
| InChI Key: | XLLJFWFFIDCGMI-UHFFFAOYSA-N |