2-nitro-N-[2-(pyridin-4-yl)ethyl]-4-(trifluoromethyl)aniline
Chemical Structure Depiction of
2-nitro-N-[2-(pyridin-4-yl)ethyl]-4-(trifluoromethyl)aniline
2-nitro-N-[2-(pyridin-4-yl)ethyl]-4-(trifluoromethyl)aniline
Compound characteristics
| Compound ID: | 8014-8777 |
| Compound Name: | 2-nitro-N-[2-(pyridin-4-yl)ethyl]-4-(trifluoromethyl)aniline |
| Molecular Weight: | 311.26 |
| Molecular Formula: | C14 H12 F3 N3 O2 |
| Smiles: | C(CNc1ccc(cc1[N+]([O-])=O)C(F)(F)F)c1ccncc1 |
| Stereo: | ACHIRAL |
| logP: | 2.9902 |
| logD: | 2.9453 |
| logSw: | -3.3703 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.125 |
| InChI Key: | RRUALNCTYINLIR-UHFFFAOYSA-N |