3-(4-tert-butylphenyl)-3-[2-(2,5-dimethylphenoxy)acetamido]propanoic acid
Chemical Structure Depiction of
3-(4-tert-butylphenyl)-3-[2-(2,5-dimethylphenoxy)acetamido]propanoic acid
3-(4-tert-butylphenyl)-3-[2-(2,5-dimethylphenoxy)acetamido]propanoic acid
Compound characteristics
| Compound ID: | 8014-8994 |
| Compound Name: | 3-(4-tert-butylphenyl)-3-[2-(2,5-dimethylphenoxy)acetamido]propanoic acid |
| Molecular Weight: | 383.49 |
| Molecular Formula: | C23 H29 N O4 |
| Smiles: | Cc1ccc(C)c(c1)OCC(NC(CC(O)=O)c1ccc(cc1)C(C)(C)C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.9767 |
| logD: | 2.3389 |
| logSw: | -4.5634 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 60.038 |
| InChI Key: | LXXPQKRUOVOJRH-IBGZPJMESA-N |