2-[5-(2-chlorophenyl)furan-2-yl]-N-(4-fluorophenyl)quinoline-4-carboxamide
Chemical Structure Depiction of
2-[5-(2-chlorophenyl)furan-2-yl]-N-(4-fluorophenyl)quinoline-4-carboxamide
2-[5-(2-chlorophenyl)furan-2-yl]-N-(4-fluorophenyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | 8014-9132 |
| Compound Name: | 2-[5-(2-chlorophenyl)furan-2-yl]-N-(4-fluorophenyl)quinoline-4-carboxamide |
| Molecular Weight: | 442.88 |
| Molecular Formula: | C26 H16 Cl F N2 O2 |
| Smiles: | c1ccc(c(c1)c1ccc(c2cc(C(Nc3ccc(cc3)F)=O)c3ccccc3n2)o1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 6.8614 |
| logD: | 6.8614 |
| logSw: | -6.5489 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.788 |
| InChI Key: | JJXDIZVRLIHJAL-UHFFFAOYSA-N |