N-[1-(3,4-dimethylphenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-3-methoxybenzamide
Chemical Structure Depiction of
N-[1-(3,4-dimethylphenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-3-methoxybenzamide
N-[1-(3,4-dimethylphenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-3-methoxybenzamide
Compound characteristics
| Compound ID: | 8014-9247 |
| Compound Name: | N-[1-(3,4-dimethylphenyl)-6,6-dimethyl-2,4-dioxo-3-(trifluoromethyl)-2,3,4,5,6,7-hexahydro-1H-indol-3-yl]-3-methoxybenzamide |
| Molecular Weight: | 500.52 |
| Molecular Formula: | C27 H27 F3 N2 O4 |
| Smiles: | Cc1ccc(cc1C)N1C2CC(C)(C)CC(C=2C(C1=O)(C(F)(F)F)NC(c1cccc(c1)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.1112 |
| logD: | 0.0581 |
| logSw: | -5.0547 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.255 |
| InChI Key: | ORRTTWFWDJHESJ-SANMLTNESA-N |