4-(2,3-dichlorophenyl)-1-(4-fluorophenyl)-7,7-dimethyl-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
Chemical Structure Depiction of
4-(2,3-dichlorophenyl)-1-(4-fluorophenyl)-7,7-dimethyl-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
4-(2,3-dichlorophenyl)-1-(4-fluorophenyl)-7,7-dimethyl-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
Compound characteristics
| Compound ID: | 8014-9394 |
| Compound Name: | 4-(2,3-dichlorophenyl)-1-(4-fluorophenyl)-7,7-dimethyl-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione |
| Molecular Weight: | 432.32 |
| Molecular Formula: | C23 H20 Cl2 F N O2 |
| Smiles: | CC1(C)CC2=C(C(CC(N2c2ccc(cc2)F)=O)c2cccc(c2[Cl])[Cl])C(C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.0734 |
| logD: | 5.0734 |
| logSw: | -5.2424 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.586 |
| InChI Key: | RFQRCRSYHJVAOJ-INIZCTEOSA-N |