N-(4-bromophenyl)-2-(thiophene-2-sulfonyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide
Chemical Structure Depiction of
N-(4-bromophenyl)-2-(thiophene-2-sulfonyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide
N-(4-bromophenyl)-2-(thiophene-2-sulfonyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide
Compound characteristics
| Compound ID: | 8014-9483 |
| Compound Name: | N-(4-bromophenyl)-2-(thiophene-2-sulfonyl)-1,2,3,4-tetrahydroisoquinoline-3-carboxamide |
| Molecular Weight: | 477.4 |
| Molecular Formula: | C20 H17 Br N2 O3 S2 |
| Smiles: | C1C(C(Nc2ccc(cc2)[Br])=O)N(Cc2ccccc12)S(c1cccs1)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8004 |
| logD: | 4.7789 |
| logSw: | -4.7916 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.192 |
| InChI Key: | NKKYHFAKFOOSAJ-SFHVURJKSA-N |