4-phenyl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
Chemical Structure Depiction of
4-phenyl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
4-phenyl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione
Compound characteristics
| Compound ID: | 8014-9656 |
| Compound Name: | 4-phenyl-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydroquinoline-2,5(1H,3H)-dione |
| Molecular Weight: | 385.38 |
| Molecular Formula: | C22 H18 F3 N O2 |
| Smiles: | C1CC2=C(C(CC(N2c2cccc(c2)C(F)(F)F)=O)c2ccccc2)C(C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9636 |
| logD: | 3.9636 |
| logSw: | -4.3281 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 28.586 |
| InChI Key: | BNQZKWVYYGOLQV-QGZVFWFLSA-N |