6-(bromomethyl)-3-(4-chlorophenyl)-5,6-dihydro[1,3]thiazolo[2,3-c][1,2,4]triazole
Chemical Structure Depiction of
6-(bromomethyl)-3-(4-chlorophenyl)-5,6-dihydro[1,3]thiazolo[2,3-c][1,2,4]triazole
6-(bromomethyl)-3-(4-chlorophenyl)-5,6-dihydro[1,3]thiazolo[2,3-c][1,2,4]triazole
Compound characteristics
| Compound ID: | 8014-9964 |
| Compound Name: | 6-(bromomethyl)-3-(4-chlorophenyl)-5,6-dihydro[1,3]thiazolo[2,3-c][1,2,4]triazole |
| Molecular Weight: | 330.63 |
| Molecular Formula: | C11 H9 Br Cl N3 S |
| Smiles: | C1C(C[Br])Sc2nnc(c3ccc(cc3)[Cl])n12 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8461 |
| logD: | 3.8289 |
| logSw: | -4.548 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.1238 |
| InChI Key: | NOQFYRPCLHPOMR-VIFPVBQESA-N |