5-bromo-3-[2-(3,4-diethoxyphenyl)acetamido]-1-benzofuran-2-carboxamide
Chemical Structure Depiction of
5-bromo-3-[2-(3,4-diethoxyphenyl)acetamido]-1-benzofuran-2-carboxamide
5-bromo-3-[2-(3,4-diethoxyphenyl)acetamido]-1-benzofuran-2-carboxamide
Compound characteristics
| Compound ID: | 8015-0020 |
| Compound Name: | 5-bromo-3-[2-(3,4-diethoxyphenyl)acetamido]-1-benzofuran-2-carboxamide |
| Molecular Weight: | 461.31 |
| Molecular Formula: | C21 H21 Br N2 O5 |
| Smiles: | CCOc1ccc(CC(Nc2c3cc(ccc3oc2C(N)=O)[Br])=O)cc1OCC |
| Stereo: | ACHIRAL |
| logP: | 2.7172 |
| logD: | 2.7093 |
| logSw: | -2.9509 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 78.726 |
| InChI Key: | LPPHGMAHTRVVGH-UHFFFAOYSA-N |