ethyl 3-[(4-acetamidobenzene-1-sulfonyl)amino]-3-(4-ethoxyphenyl)propanoate
Chemical Structure Depiction of
ethyl 3-[(4-acetamidobenzene-1-sulfonyl)amino]-3-(4-ethoxyphenyl)propanoate
ethyl 3-[(4-acetamidobenzene-1-sulfonyl)amino]-3-(4-ethoxyphenyl)propanoate
Compound characteristics
| Compound ID: | 8015-0190 |
| Compound Name: | ethyl 3-[(4-acetamidobenzene-1-sulfonyl)amino]-3-(4-ethoxyphenyl)propanoate |
| Molecular Weight: | 434.51 |
| Molecular Formula: | C21 H26 N2 O6 S |
| Smiles: | CCOC(CC(c1ccc(cc1)OCC)NS(c1ccc(cc1)NC(C)=O)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1402 |
| logD: | 3.1399 |
| logSw: | -3.436 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 92.385 |
| InChI Key: | DKIXTFCLUSBWSK-FQEVSTJZSA-N |