N-cyclohexyl-N'-(4-ethylphenyl)-N-(3-{[(4-ethylphenyl)carbamothioyl]amino}propyl)thiourea
Chemical Structure Depiction of
N-cyclohexyl-N'-(4-ethylphenyl)-N-(3-{[(4-ethylphenyl)carbamothioyl]amino}propyl)thiourea
N-cyclohexyl-N'-(4-ethylphenyl)-N-(3-{[(4-ethylphenyl)carbamothioyl]amino}propyl)thiourea
Compound characteristics
| Compound ID: | 8015-0264 |
| Compound Name: | N-cyclohexyl-N'-(4-ethylphenyl)-N-(3-{[(4-ethylphenyl)carbamothioyl]amino}propyl)thiourea |
| Molecular Weight: | 482.75 |
| Molecular Formula: | C27 H38 N4 S2 |
| Smiles: | CCc1ccc(cc1)NC(NCCCN(C1CCCCC1)C(Nc1ccc(CC)cc1)=S)=S |
| Stereo: | ACHIRAL |
| logP: | 7.4248 |
| logD: | 7.4248 |
| logSw: | -5.7194 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 29.9087 |
| InChI Key: | RMKMNHFTHGTXFB-UHFFFAOYSA-N |