methyl 7-(furan-2-yl)-4-(3-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Chemical Structure Depiction of
methyl 7-(furan-2-yl)-4-(3-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
methyl 7-(furan-2-yl)-4-(3-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate
Compound characteristics
| Compound ID: | 8015-0369 |
| Compound Name: | methyl 7-(furan-2-yl)-4-(3-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxylate |
| Molecular Weight: | 393.44 |
| Molecular Formula: | C23 H23 N O5 |
| Smiles: | CC1=C(C(C2=C(CC(CC2=O)c2ccco2)N1)c1cccc(c1)OC)C(=O)OC |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.7115 |
| logD: | -0.6343 |
| logSw: | -4.0434 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.946 |
| InChI Key: | BIWIUQSKGJADSR-UHFFFAOYSA-N |