N-ethyl-N'-(2-phenylethyl)-N-[(pyridin-4-yl)methyl]thiourea
Chemical Structure Depiction of
N-ethyl-N'-(2-phenylethyl)-N-[(pyridin-4-yl)methyl]thiourea
N-ethyl-N'-(2-phenylethyl)-N-[(pyridin-4-yl)methyl]thiourea
Compound characteristics
| Compound ID: | 8015-0437 |
| Compound Name: | N-ethyl-N'-(2-phenylethyl)-N-[(pyridin-4-yl)methyl]thiourea |
| Molecular Weight: | 299.44 |
| Molecular Formula: | C17 H21 N3 S |
| Smiles: | CCN(Cc1ccncc1)C(NCCc1ccccc1)=S |
| Stereo: | ACHIRAL |
| logP: | 2.4611 |
| logD: | 2.4425 |
| logSw: | -2.2843 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 21.016 |
| InChI Key: | WTDSWWZXYSKMSK-UHFFFAOYSA-N |