ethyl 3-(4-methylphenyl)-3-[(phenylmethanesulfonyl)amino]propanoate
Chemical Structure Depiction of
ethyl 3-(4-methylphenyl)-3-[(phenylmethanesulfonyl)amino]propanoate
ethyl 3-(4-methylphenyl)-3-[(phenylmethanesulfonyl)amino]propanoate
Compound characteristics
| Compound ID: | 8015-0511 |
| Compound Name: | ethyl 3-(4-methylphenyl)-3-[(phenylmethanesulfonyl)amino]propanoate |
| Molecular Weight: | 361.46 |
| Molecular Formula: | C19 H23 N O4 S |
| Smiles: | CCOC(CC(c1ccc(C)cc1)NS(Cc1ccccc1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4423 |
| logD: | 3.4422 |
| logSw: | -3.4832 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.626 |
| InChI Key: | OTOKFSCLVZSCLO-SFHVURJKSA-N |