4-methoxy-3-nitro-N-[2-(4-phenylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide
Chemical Structure Depiction of
4-methoxy-3-nitro-N-[2-(4-phenylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide
4-methoxy-3-nitro-N-[2-(4-phenylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide
Compound characteristics
| Compound ID: | 8015-0954 |
| Compound Name: | 4-methoxy-3-nitro-N-[2-(4-phenylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]benzamide |
| Molecular Weight: | 500.48 |
| Molecular Formula: | C25 H23 F3 N4 O4 |
| Smiles: | COc1ccc(cc1[N+]([O-])=O)C(Nc1cc(ccc1N1CCN(CC1)c1ccccc1)C(F)(F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2728 |
| logD: | 2.9869 |
| logSw: | -5.3308 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.755 |
| InChI Key: | KMLCKQPYQHAFJH-UHFFFAOYSA-N |