3-(2-chlorobenzamido)-N-(4-fluorophenyl)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide
Chemical Structure Depiction of
3-(2-chlorobenzamido)-N-(4-fluorophenyl)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide
3-(2-chlorobenzamido)-N-(4-fluorophenyl)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide
Compound characteristics
| Compound ID: | 8015-1034 |
| Compound Name: | 3-(2-chlorobenzamido)-N-(4-fluorophenyl)-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| Molecular Weight: | 453.92 |
| Molecular Formula: | C23 H17 Cl F N3 O2 S |
| Smiles: | Cc1cc(C)nc2c1c(c(C(Nc1ccc(cc1)F)=O)s2)NC(c1ccccc1[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.8182 |
| logD: | 4.6687 |
| logSw: | -4.8899 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.552 |
| InChI Key: | YGAVETXVVISHTG-UHFFFAOYSA-N |