N-(2-cyano-4,5-diethoxyphenyl)-2-[(2,3-dihydro-1H-inden-5-yl)oxy]acetamide
Chemical Structure Depiction of
N-(2-cyano-4,5-diethoxyphenyl)-2-[(2,3-dihydro-1H-inden-5-yl)oxy]acetamide
N-(2-cyano-4,5-diethoxyphenyl)-2-[(2,3-dihydro-1H-inden-5-yl)oxy]acetamide
Compound characteristics
| Compound ID: | 8015-1140 |
| Compound Name: | N-(2-cyano-4,5-diethoxyphenyl)-2-[(2,3-dihydro-1H-inden-5-yl)oxy]acetamide |
| Molecular Weight: | 380.44 |
| Molecular Formula: | C22 H24 N2 O4 |
| Smiles: | CCOc1cc(C#N)c(cc1OCC)NC(COc1ccc2CCCc2c1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3028 |
| logD: | 3.2779 |
| logSw: | -3.5856 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.681 |
| InChI Key: | WJHASMZDTYTDQS-UHFFFAOYSA-N |