3-benzyl-1-(3-bromo-4-methylphenyl)pyrrolidine-2,5-dione
Chemical Structure Depiction of
3-benzyl-1-(3-bromo-4-methylphenyl)pyrrolidine-2,5-dione
3-benzyl-1-(3-bromo-4-methylphenyl)pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 8015-1142 |
| Compound Name: | 3-benzyl-1-(3-bromo-4-methylphenyl)pyrrolidine-2,5-dione |
| Molecular Weight: | 358.23 |
| Molecular Formula: | C18 H16 Br N O2 |
| Smiles: | Cc1ccc(cc1[Br])N1C(CC(Cc2ccccc2)C1=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1064 |
| logD: | 4.1064 |
| logSw: | -4.2695 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 29.1576 |
| InChI Key: | ZFMJFWBMVCGLNU-CQSZACIVSA-N |