2-(4-cyclohexylphenoxy)-4,6-bis(morpholin-4-yl)-1,3,5-triazine
Chemical Structure Depiction of
2-(4-cyclohexylphenoxy)-4,6-bis(morpholin-4-yl)-1,3,5-triazine
2-(4-cyclohexylphenoxy)-4,6-bis(morpholin-4-yl)-1,3,5-triazine
Compound characteristics
| Compound ID: | 8015-1267 |
| Compound Name: | 2-(4-cyclohexylphenoxy)-4,6-bis(morpholin-4-yl)-1,3,5-triazine |
| Molecular Weight: | 425.53 |
| Molecular Formula: | C23 H31 N5 O3 |
| Smiles: | C1CCC(CC1)c1ccc(cc1)Oc1nc(nc(n1)N1CCOCC1)N1CCOCC1 |
| Stereo: | ACHIRAL |
| logP: | 5.7097 |
| logD: | 5.7097 |
| logSw: | -5.785 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 57.15 |
| InChI Key: | MNVZOHVARDDHIX-UHFFFAOYSA-N |