N-[2-(4-chlorophenyl)ethyl]-4-cyclohexylbenzene-1-sulfonamide
Chemical Structure Depiction of
N-[2-(4-chlorophenyl)ethyl]-4-cyclohexylbenzene-1-sulfonamide
N-[2-(4-chlorophenyl)ethyl]-4-cyclohexylbenzene-1-sulfonamide
Compound characteristics
| Compound ID: | 8015-1846 |
| Compound Name: | N-[2-(4-chlorophenyl)ethyl]-4-cyclohexylbenzene-1-sulfonamide |
| Molecular Weight: | 377.93 |
| Molecular Formula: | C20 H24 Cl N O2 S |
| Smiles: | C1CCC(CC1)c1ccc(cc1)S(NCCc1ccc(cc1)[Cl])(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.9984 |
| logD: | 5.9983 |
| logSw: | -6.5362 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.759 |
| InChI Key: | ZZFFKZDSRAOVBY-UHFFFAOYSA-N |