7-(3,4-dimethoxyphenyl)-1,3-dimethyl-8-(4-methylphenyl)-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione
Chemical Structure Depiction of
7-(3,4-dimethoxyphenyl)-1,3-dimethyl-8-(4-methylphenyl)-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione
7-(3,4-dimethoxyphenyl)-1,3-dimethyl-8-(4-methylphenyl)-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione
Compound characteristics
| Compound ID: | 8015-1982 |
| Compound Name: | 7-(3,4-dimethoxyphenyl)-1,3-dimethyl-8-(4-methylphenyl)-1H-imidazo[2,1-f]purine-2,4(3H,8H)-dione |
| Molecular Weight: | 445.48 |
| Molecular Formula: | C24 H23 N5 O4 |
| Smiles: | Cc1ccc(cc1)N1C(=Cn2c3C(N(C)C(N(C)c3nc12)=O)=O)c1ccc(c(c1)OC)OC |
| Stereo: | ACHIRAL |
| logP: | 3.5947 |
| logD: | 3.5947 |
| logSw: | -3.6537 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 58.603 |
| InChI Key: | FGTMQFUDBNQMBU-UHFFFAOYSA-N |