7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethyl-8-(morpholin-4-yl)-3,7-dihydro-1H-purine-2,6-dione
Chemical Structure Depiction of
7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethyl-8-(morpholin-4-yl)-3,7-dihydro-1H-purine-2,6-dione
7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethyl-8-(morpholin-4-yl)-3,7-dihydro-1H-purine-2,6-dione
Compound characteristics
| Compound ID: | 8015-1984 |
| Compound Name: | 7-[2-(3,4-dimethoxyphenyl)-2-oxoethyl]-1,3-dimethyl-8-(morpholin-4-yl)-3,7-dihydro-1H-purine-2,6-dione |
| Molecular Weight: | 443.46 |
| Molecular Formula: | C21 H25 N5 O6 |
| Smiles: | CN1C(c2c(nc(N3CCOCC3)n2CC(c2ccc(c(c2)OC)OC)=O)N(C)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.7271 |
| logD: | 1.727 |
| logSw: | -2.3236 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 82.114 |
| InChI Key: | UFTUWRRKKYFJEE-UHFFFAOYSA-N |