5-amino-N-(3-chloro-4-fluorophenyl)-3-ethyl-1,2-oxazole-4-carboxamide
Chemical Structure Depiction of
5-amino-N-(3-chloro-4-fluorophenyl)-3-ethyl-1,2-oxazole-4-carboxamide
5-amino-N-(3-chloro-4-fluorophenyl)-3-ethyl-1,2-oxazole-4-carboxamide
Compound characteristics
| Compound ID: | 8015-2128 |
| Compound Name: | 5-amino-N-(3-chloro-4-fluorophenyl)-3-ethyl-1,2-oxazole-4-carboxamide |
| Molecular Weight: | 283.69 |
| Molecular Formula: | C12 H11 Cl F N3 O2 |
| Smiles: | CCc1c(C(Nc2ccc(c(c2)[Cl])F)=O)c(N)on1 |
| Stereo: | ACHIRAL |
| logP: | 2.5433 |
| logD: | 2.4678 |
| logSw: | -3.6068 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 67.431 |
| InChI Key: | YNXKJVFDOINIGP-UHFFFAOYSA-N |