N,N'-pentane-1,3-diylbis[N'-(4-ethoxyphenyl)(thiourea)]
Chemical Structure Depiction of
N,N'-pentane-1,3-diylbis[N'-(4-ethoxyphenyl)(thiourea)]
N,N'-pentane-1,3-diylbis[N'-(4-ethoxyphenyl)(thiourea)]
Compound characteristics
| Compound ID: | 8015-2345 |
| Compound Name: | N,N'-pentane-1,3-diylbis[N'-(4-ethoxyphenyl)(thiourea)] |
| Molecular Weight: | 460.66 |
| Molecular Formula: | C23 H32 N4 O2 S2 |
| Smiles: | CCC(CCNC(Nc1ccc(cc1)OCC)=S)NC(Nc1ccc(cc1)OCC)=S |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.2852 |
| logD: | 5.2852 |
| logSw: | -5.2652 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 54.797 |
| InChI Key: | IKAQQDNAIAUVJP-KRWDZBQOSA-N |