3-(3,4-dimethoxyphenyl)-3-(2-fluorobenzamido)propanoic acid
Chemical Structure Depiction of
3-(3,4-dimethoxyphenyl)-3-(2-fluorobenzamido)propanoic acid
3-(3,4-dimethoxyphenyl)-3-(2-fluorobenzamido)propanoic acid
Compound characteristics
| Compound ID: | 8015-2352 |
| Compound Name: | 3-(3,4-dimethoxyphenyl)-3-(2-fluorobenzamido)propanoic acid |
| Molecular Weight: | 347.34 |
| Molecular Formula: | C18 H18 F N O5 |
| Smiles: | COc1ccc(cc1OC)C(CC(O)=O)NC(c1ccccc1F)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.1668 |
| logD: | -0.471 |
| logSw: | -2.9345 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 67.927 |
| InChI Key: | GFWREHQIMVQCLQ-AWEZNQCLSA-N |