N-(2,4-dimethoxyphenyl)-2-{4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl}quinazolin-4-amine
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-2-{4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl}quinazolin-4-amine
N-(2,4-dimethoxyphenyl)-2-{4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl}quinazolin-4-amine
Compound characteristics
| Compound ID: | 8015-2425 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-2-{4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]piperazin-1-yl}quinazolin-4-amine |
| Molecular Weight: | 542.63 |
| Molecular Formula: | C29 H27 F N6 O2 S |
| Smiles: | COc1ccc(c(c1)OC)Nc1c2ccccc2nc(n1)N1CCN(CC1)c1nc(cs1)c1ccc(cc1)F |
| Stereo: | ACHIRAL |
| logP: | 7.7185 |
| logD: | 7.6156 |
| logSw: | -6.0666 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.742 |
| InChI Key: | IVTFMZAPBSUOLL-UHFFFAOYSA-N |