5-({[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}methyl)-3-phenyl-1,2,4-oxadiazole
Chemical Structure Depiction of
5-({[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}methyl)-3-phenyl-1,2,4-oxadiazole
5-({[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}methyl)-3-phenyl-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | 8015-2446 |
| Compound Name: | 5-({[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}methyl)-3-phenyl-1,2,4-oxadiazole |
| Molecular Weight: | 370.81 |
| Molecular Formula: | C17 H11 Cl N4 O2 S |
| Smiles: | C(c1nc(c2ccccc2)no1)Sc1nnc(c2ccc(cc2)[Cl])o1 |
| Stereo: | ACHIRAL |
| logP: | 4.7183 |
| logD: | 4.7183 |
| logSw: | -5.1528 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 61.407 |
| InChI Key: | UGKNRVYVPNHLIT-UHFFFAOYSA-N |