1-[(2,2-dichlorocyclopropyl)methyl]-2-(trifluoromethyl)-1H-benzimidazole
Chemical Structure Depiction of
1-[(2,2-dichlorocyclopropyl)methyl]-2-(trifluoromethyl)-1H-benzimidazole
1-[(2,2-dichlorocyclopropyl)methyl]-2-(trifluoromethyl)-1H-benzimidazole
Compound characteristics
| Compound ID: | 8015-2925 |
| Compound Name: | 1-[(2,2-dichlorocyclopropyl)methyl]-2-(trifluoromethyl)-1H-benzimidazole |
| Molecular Weight: | 309.12 |
| Molecular Formula: | C12 H9 Cl2 F3 N2 |
| Smiles: | C1C(Cn2c3ccccc3nc2C(F)(F)F)C1([Cl])[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3207 |
| logD: | 4.3207 |
| logSw: | -4.551 |
| Hydrogen bond acceptors count: | 1 |
| Polar surface area: | 10.6902 |
| InChI Key: | RRRSFVVLCUGDBF-ZETCQYMHSA-N |