2-(hydroxymethyl)-N-(2-methoxyphenyl)piperidine-1-carbothioamide
Chemical Structure Depiction of
2-(hydroxymethyl)-N-(2-methoxyphenyl)piperidine-1-carbothioamide
2-(hydroxymethyl)-N-(2-methoxyphenyl)piperidine-1-carbothioamide
Compound characteristics
| Compound ID: | 8015-3016 |
| Compound Name: | 2-(hydroxymethyl)-N-(2-methoxyphenyl)piperidine-1-carbothioamide |
| Molecular Weight: | 280.39 |
| Molecular Formula: | C14 H20 N2 O2 S |
| Smiles: | COc1ccccc1NC(N1CCCCC1CO)=S |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5197 |
| logD: | 2.5197 |
| logSw: | -2.462 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 34.831 |
| InChI Key: | YXFKQKLTBSBNFG-LLVKDONJSA-N |