5-(5-bromothiophen-2-yl)-3-phenyl-2-sulfanylidene-2,3-dihydro[1,3]thiazolo[4,5-d]pyrimidin-7(6H)-one
					Chemical Structure Depiction of
5-(5-bromothiophen-2-yl)-3-phenyl-2-sulfanylidene-2,3-dihydro[1,3]thiazolo[4,5-d]pyrimidin-7(6H)-one
			5-(5-bromothiophen-2-yl)-3-phenyl-2-sulfanylidene-2,3-dihydro[1,3]thiazolo[4,5-d]pyrimidin-7(6H)-one
Compound characteristics
| Compound ID: | 8015-3098 | 
| Compound Name: | 5-(5-bromothiophen-2-yl)-3-phenyl-2-sulfanylidene-2,3-dihydro[1,3]thiazolo[4,5-d]pyrimidin-7(6H)-one | 
| Molecular Weight: | 422.34 | 
| Molecular Formula: | C15 H8 Br N3 O S3 | 
| Smiles: | c1ccc(cc1)N1C2=C(C(NC(c3ccc(s3)[Br])=N2)=O)SC1=S | 
| Stereo: | ACHIRAL | 
| logP: | 3.9369 | 
| logD: | 3.9099 | 
| logSw: | -4.2183 | 
| Hydrogen bond acceptors count: | 6 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 37.704 | 
| InChI Key: | GJRZJWVHWMGMPF-UHFFFAOYSA-N | 
 
				 
				