4-fluoro-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]benzamide
Chemical Structure Depiction of
4-fluoro-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]benzamide
4-fluoro-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]benzamide
Compound characteristics
| Compound ID: | 8015-3527 |
| Compound Name: | 4-fluoro-N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dimethylphenyl]benzamide |
| Molecular Weight: | 409.3 |
| Molecular Formula: | C18 H14 F7 N O2 |
| Smiles: | Cc1cc(cc(C)c1NC(c1ccc(cc1)F)=O)C(C(F)(F)F)(C(F)(F)F)O |
| Stereo: | ACHIRAL |
| logP: | 3.9365 |
| logD: | 3.8675 |
| logSw: | -4.0024 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 37.002 |
| InChI Key: | QUKNNEKYCJOSET-UHFFFAOYSA-N |