3-[(4-methylphenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione
Chemical Structure Depiction of
3-[(4-methylphenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione
3-[(4-methylphenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | 8015-3577 |
| Compound Name: | 3-[(4-methylphenyl)methyl]-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione |
| Molecular Weight: | 363.33 |
| Molecular Formula: | C19 H16 F3 N O3 |
| Smiles: | Cc1ccc(CC2CC(N(C2=O)c2ccc(cc2)OC(F)(F)F)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3413 |
| logD: | 4.3413 |
| logSw: | -4.3421 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 35.094 |
| InChI Key: | BDJARQUVIMCVJS-CQSZACIVSA-N |