4-chloro-3-nitro-1-phenylquinolin-2(1H)-one
Chemical Structure Depiction of
4-chloro-3-nitro-1-phenylquinolin-2(1H)-one
4-chloro-3-nitro-1-phenylquinolin-2(1H)-one
Compound characteristics
| Compound ID: | 8015-3849 |
| Compound Name: | 4-chloro-3-nitro-1-phenylquinolin-2(1H)-one |
| Molecular Weight: | 300.7 |
| Molecular Formula: | C15 H9 Cl N2 O3 |
| Smiles: | c1ccc(cc1)N1C(C(=C(c2ccccc12)[Cl])[N+]([O-])=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.285 |
| logD: | 3.285 |
| logSw: | -3.8609 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 48.029 |
| InChI Key: | XMVBIQDOMQZCFV-UHFFFAOYSA-N |